C19H16INO2S — CID 102187535
4-iodo-2-(4-methylphenyl)sulfonyl-1,3-dihydrobenzo[f]isoindole (PubChem CID 102187535) has the molecular formula C19H16INO2S and a molecular weight of 449.31 g/mol. Its IUPAC name is 4-iodo-2-(4-methylphenyl)sulfonyl-1,3-dihydrobenzo[f]isoindole.
| Compound Name | 4-iodo-2-(4-methylphenyl)sulfonyl-1,3-dihydrobenzo[f]isoindole |
|---|---|
| PubChem CID | 102187535 |
| Molecular Formula | C19H16INO2S |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | 4-iodo-2-(4-methylphenyl)sulfonyl-1,3-dihydrobenzo[f]isoindole |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3cc4ccccc4c(I)c3C2)cc1 |
| InChI | InChI=1S/C19H16INO2S/c1-13-6-8-16(9-7-13)24(22,23)21-11-15-10-14-4-2-3-5-17(14)19(20)18(15)12-21/h2-10H,11-12H2,1H3 |
| InChIKey | OZEZOEUZTXEDLO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|