C23H19NO2S — CID 102156687
13-methyl-11-(4-methylphenyl)sulfonyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene (PubChem CID 102156687) has the molecular formula C23H19NO2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 13-methyl-11-(4-methylphenyl)sulfonyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene.
| Compound Name | 13-methyl-11-(4-methylphenyl)sulfonyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene |
|---|---|
| PubChem CID | 102156687 |
| Molecular Formula | C23H19NO2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 13-methyl-11-(4-methylphenyl)sulfonyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaene |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3cc4ccccc4c4ccc(C)c2c34)cc1 |
| InChI | InChI=1S/C23H19NO2S/c1-15-7-10-19(11-8-15)27(25,26)24-14-18-13-17-5-3-4-6-20(17)21-12-9-16(2)23(24)22(18)21/h3-13H,14H2,1-2H3 |
| InChIKey | HZNIOFNBIZIFSZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|