C17H17NO3S — CID 25136623
3-methylidene-4-(4-methylphenyl)sulfonyl-5H-1,4-benzoxazepine (PubChem CID 25136623) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 3-methylidene-4-(4-methylphenyl)sulfonyl-5H-1,4-benzoxazepine.
| Compound Name | 3-methylidene-4-(4-methylphenyl)sulfonyl-5H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 25136623 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3-methylidene-4-(4-methylphenyl)sulfonyl-5H-1,4-benzoxazepine |
| SMILES | C=C1COc2ccccc2CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H17NO3S/c1-13-7-9-16(10-8-13)22(19,20)18-11-15-5-3-4-6-17(15)21-12-14(18)2/h3-10H,2,11-12H2,1H3 |
| InChIKey | VXONBCQIXXGJAC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |