C21H23NO3S — CID 25137087
11-(4-methylphenyl)sulfonyl-6,7,8,9,10,12-hexahydrobenzo[c][1,5]benzoxazocine (PubChem CID 25137087) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 11-(4-methylphenyl)sulfonyl-6,7,8,9,10,12-hexahydrobenzo[c][1,5]benzoxazocine.
| Compound Name | 11-(4-methylphenyl)sulfonyl-6,7,8,9,10,12-hexahydrobenzo[c][1,5]benzoxazocine |
|---|---|
| PubChem CID | 25137087 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 11-(4-methylphenyl)sulfonyl-6,7,8,9,10,12-hexahydrobenzo[c][1,5]benzoxazocine |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3ccccc3OCC3=C2CCCC3)cc1 |
| InChI | InChI=1S/C21H23NO3S/c1-16-10-12-19(13-11-16)26(23,24)22-14-17-6-3-5-9-21(17)25-15-18-7-2-4-8-20(18)22/h3,5-6,9-13H,2,4,7-8,14-15H2,1H3 |
| InChIKey | GFXUESUXHWIFRK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |