C22H18BrNO3S — CID 138973498
2-(4-bromophenyl)sulfonyl-4-(4-methylphenyl)-1,4-dihydroisoquinolin-3-one (PubChem CID 138973498) has the molecular formula C22H18BrNO3S and a molecular weight of 456.36 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfonyl-4-(4-methylphenyl)-1,4-dihydroisoquinolin-3-one.
| Compound Name | 2-(4-bromophenyl)sulfonyl-4-(4-methylphenyl)-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 138973498 |
| Molecular Formula | C22H18BrNO3S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 2-(4-bromophenyl)sulfonyl-4-(4-methylphenyl)-1,4-dihydroisoquinolin-3-one |
| SMILES | Cc1ccc(C2C(=O)N(S(=O)(=O)c3ccc(Br)cc3)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C22H18BrNO3S/c1-15-6-8-16(9-7-15)21-20-5-3-2-4-17(20)14-24(22(21)25)28(26,27)19-12-10-18(23)11-13-19/h2-13,21H,14H2,1H3 |
| InChIKey | BKXCNVRLNLIPKF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |