C40H36N2O4S2 — CID 132606613
(4R,13R,19S,28S)-12,20-bis-(4-methylphenyl)sulfonyl-12,20-diazaheptacyclo[15.11.0.03,15.04,13.05,10.019,28.022,27]octacosa-1(17),2,5,7,9,15,22,24,26-nonaene (PubChem CID 132606613) has the molecular formula C40H36N2O4S2 and a molecular weight of 672.87 g/mol. Its IUPAC name is (4R,13R,19S,28S)-12,20-bis-(4-methylphenyl)sulfonyl-12,20-diazaheptacyclo[15.11.0.03,15.04,13.05,10.019,28.022,27]octacosa-1(17),2,5,7,9,15,22,24,26-nonaene.
| Compound Name | (4R,13R,19S,28S)-12,20-bis-(4-methylphenyl)sulfonyl-12,20-diazaheptacyclo[15.11.0.03,15.04,13.05,10.019,28.022,27]octacosa-1(17),2,5,7,9,15,22,24,26-nonaene |
|---|---|
| PubChem CID | 132606613 |
| Molecular Formula | C40H36N2O4S2 |
| Molecular Weight | 672.87 g/mol |
| Exact Mass | 672.21 |
| IUPAC Name | (4R,13R,19S,28S)-12,20-bis-(4-methylphenyl)sulfonyl-12,20-diazaheptacyclo[15.11.0.03,15.04,13.05,10.019,28.022,27]octacosa-1(17),2,5,7,9,15,22,24,26-nonaene |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3ccccc3[C@H]3c4cc5c(cc4C[C@H]32)C[C@H]2[C@@H]5c3ccccc3CN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C40H36N2O4S2/c1-25-11-15-31(16-12-25)47(43,44)41-23-27-7-3-5-9-33(27)39-35-22-36-30(19-29(35)20-37(39)41)21-38-40(36)34-10-6-4-8-28(34)24-42(38)48(45,46)32-17-13-26(2)14-18-32/h3-19,22,37-40H,20-21,23-24H2,1-2H3/t37-,38+,39+,40- |
| InChIKey | ZNKLPNQQKNSEOC-AJXFNKDUSA-N |
| XLogP | 6.83 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.87 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |