C24H23NO2S — CID 166448631
(6aS,7R,11bS)-7-methyl-6-(4-methylphenyl)sulfonyl-5,6a,7,11b-tetrahydroindeno[2,1-c]isoquinoline (PubChem CID 166448631) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is (6aS,7R,11bS)-7-methyl-6-(4-methylphenyl)sulfonyl-5,6a,7,11b-tetrahydroindeno[2,1-c]isoquinoline.
| Compound Name | (6aS,7R,11bS)-7-methyl-6-(4-methylphenyl)sulfonyl-5,6a,7,11b-tetrahydroindeno[2,1-c]isoquinoline |
|---|---|
| PubChem CID | 166448631 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (6aS,7R,11bS)-7-methyl-6-(4-methylphenyl)sulfonyl-5,6a,7,11b-tetrahydroindeno[2,1-c]isoquinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3ccccc3[C@@H]3c4ccccc4[C@@H](C)[C@@H]32)cc1 |
| InChI | InChI=1S/C24H23NO2S/c1-16-11-13-19(14-12-16)28(26,27)25-15-18-7-3-4-9-21(18)23-22-10-6-5-8-20(22)17(2)24(23)25/h3-14,17,23-24H,15H2,1-2H3/t17-,23-,24+/m1/s1 |
| InChIKey | DFCHOMJITLJORH-VEYWIMSWSA-N |
| XLogP | 4.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |