C24H23Br2NO2S — CID 164682679
2,4-bis(4-bromophenyl)-1-(4-methylphenyl)sulfonylpiperidine (PubChem CID 164682679) has the molecular formula C24H23Br2NO2S and a molecular weight of 549.33 g/mol. Its IUPAC name is 2,4-bis(4-bromophenyl)-1-(4-methylphenyl)sulfonylpiperidine.
| Compound Name | 2,4-bis(4-bromophenyl)-1-(4-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 164682679 |
| Molecular Formula | C24H23Br2NO2S |
| Molecular Weight | 549.33 g/mol |
| Exact Mass | 546.98 |
| IUPAC Name | 2,4-bis(4-bromophenyl)-1-(4-methylphenyl)sulfonylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3ccc(Br)cc3)CC2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H23Br2NO2S/c1-17-2-12-23(13-3-17)30(28,29)27-15-14-20(18-4-8-21(25)9-5-18)16-24(27)19-6-10-22(26)11-7-19/h2-13,20,24H,14-16H2,1H3 |
| InChIKey | JTQVGTQCBNMTPX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.33 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |