C22H31NO2SSi — CID 101395837
trimethyl-[[(2R)-1-(4-methylphenyl)sulfonyl-4-phenylpiperidin-2-yl]methyl]silane (PubChem CID 101395837) has the molecular formula C22H31NO2SSi and a molecular weight of 401.65 g/mol. Its IUPAC name is trimethyl-[[(2R)-1-(4-methylphenyl)sulfonyl-4-phenylpiperidin-2-yl]methyl]silane.
| Compound Name | trimethyl-[[(2R)-1-(4-methylphenyl)sulfonyl-4-phenylpiperidin-2-yl]methyl]silane |
|---|---|
| PubChem CID | 101395837 |
| Molecular Formula | C22H31NO2SSi |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | trimethyl-[[(2R)-1-(4-methylphenyl)sulfonyl-4-phenylpiperidin-2-yl]methyl]silane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3ccccc3)C[C@@H]2C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C22H31NO2SSi/c1-18-10-12-22(13-11-18)26(24,25)23-15-14-20(19-8-6-5-7-9-19)16-21(23)17-27(2,3)4/h5-13,20-21H,14-17H2,1-4H3/t20?,21-/m1/s1 |
| InChIKey | RPOZNGVQRHTHGD-BPGUCPLFSA-N |
| XLogP | 5.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|