C20H25NO3S — CID 102081459
(2S,6R)-3-(4-methylphenyl)sulfonyl-6-phenyl-2-propyl-1,3-oxazinane (PubChem CID 102081459) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (2S,6R)-3-(4-methylphenyl)sulfonyl-6-phenyl-2-propyl-1,3-oxazinane.
| Compound Name | (2S,6R)-3-(4-methylphenyl)sulfonyl-6-phenyl-2-propyl-1,3-oxazinane |
|---|---|
| PubChem CID | 102081459 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2S,6R)-3-(4-methylphenyl)sulfonyl-6-phenyl-2-propyl-1,3-oxazinane |
| SMILES | CCC[C@@H]1O[C@@H](c2ccccc2)CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-3-7-20-21(25(22,23)18-12-10-16(2)11-13-18)15-14-19(24-20)17-8-5-4-6-9-17/h4-6,8-13,19-20H,3,7,14-15H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | IICVBTZAAZHQBO-UXHICEINSA-N |
| XLogP | 4.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |