C24H26N2O4S2 — CID 164682661
1,3-bis-(4-methylphenyl)sulfonyl-4-phenyl-1,3-diazinane (PubChem CID 164682661) has the molecular formula C24H26N2O4S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 1,3-bis-(4-methylphenyl)sulfonyl-4-phenyl-1,3-diazinane.
| Compound Name | 1,3-bis-(4-methylphenyl)sulfonyl-4-phenyl-1,3-diazinane |
|---|---|
| PubChem CID | 164682661 |
| Molecular Formula | C24H26N2O4S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 1,3-bis-(4-methylphenyl)sulfonyl-4-phenyl-1,3-diazinane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3ccccc3)N(S(=O)(=O)c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C24H26N2O4S2/c1-19-8-12-22(13-9-19)31(27,28)25-17-16-24(21-6-4-3-5-7-21)26(18-25)32(29,30)23-14-10-20(2)11-15-23/h3-15,24H,16-18H2,1-2H3 |
| InChIKey | JETRBSDDXKBQTR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |