C28H34N2O4S2 — CID 164682665
4-(4-tert-butylphenyl)-1,3-bis-(4-methylphenyl)sulfonyl-1,3-diazinane (PubChem CID 164682665) has the molecular formula C28H34N2O4S2 and a molecular weight of 526.72 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-1,3-bis-(4-methylphenyl)sulfonyl-1,3-diazinane.
| Compound Name | 4-(4-tert-butylphenyl)-1,3-bis-(4-methylphenyl)sulfonyl-1,3-diazinane |
|---|---|
| PubChem CID | 164682665 |
| Molecular Formula | C28H34N2O4S2 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 4-(4-tert-butylphenyl)-1,3-bis-(4-methylphenyl)sulfonyl-1,3-diazinane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3ccc(C(C)(C)C)cc3)N(S(=O)(=O)c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C28H34N2O4S2/c1-21-6-14-25(15-7-21)35(31,32)29-19-18-27(23-10-12-24(13-11-23)28(3,4)5)30(20-29)36(33,34)26-16-8-22(2)9-17-26/h6-17,27H,18-20H2,1-5H3 |
| InChIKey | BBNGYLNFCUVHOX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |