C30H34BrNO2S — CID 91970631
5-(bromomethyl)-6-(4-tert-butylphenyl)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine (PubChem CID 91970631) has the molecular formula C30H34BrNO2S and a molecular weight of 552.58 g/mol. Its IUPAC name is 5-(bromomethyl)-6-(4-tert-butylphenyl)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine.
| Compound Name | 5-(bromomethyl)-6-(4-tert-butylphenyl)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 91970631 |
| Molecular Formula | C30H34BrNO2S |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 5-(bromomethyl)-6-(4-tert-butylphenyl)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridine |
| SMILES | Cc1ccc(C2CC=C(CBr)C(c3ccc(C(C)(C)C)cc3)N2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H34BrNO2S/c1-21-6-10-23(11-7-21)28-19-14-25(20-31)29(24-12-15-26(16-13-24)30(3,4)5)32(28)35(33,34)27-17-8-22(2)9-18-27/h6-18,28-29H,19-20H2,1-5H3 |
| InChIKey | XAQPUAJCGPRLQN-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|