C15H23NO2S — CID 127259597
(2R,3R)-1-(4-methylphenyl)sulfonyl-2,3-dipropylaziridine (PubChem CID 127259597) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is (2R,3R)-1-(4-methylphenyl)sulfonyl-2,3-dipropylaziridine.
| Compound Name | (2R,3R)-1-(4-methylphenyl)sulfonyl-2,3-dipropylaziridine |
|---|---|
| PubChem CID | 127259597 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2R,3R)-1-(4-methylphenyl)sulfonyl-2,3-dipropylaziridine |
| SMILES | CCC[C@@H]1[C@@H](CCC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H23NO2S/c1-4-6-14-15(7-5-2)16(14)19(17,18)13-10-8-12(3)9-11-13/h8-11,14-15H,4-7H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | ADTOHIPDZDITBB-HUUCEWRRSA-N |
| XLogP | 3.34 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|