C13H19NO3S — CID 11334708
[(2S,3S)-1-(4-methylphenyl)sulfonyl-3-propylaziridin-2-yl]methanol (PubChem CID 11334708) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is [(2S,3S)-1-(4-methylphenyl)sulfonyl-3-propylaziridin-2-yl]methanol.
| Compound Name | [(2S,3S)-1-(4-methylphenyl)sulfonyl-3-propylaziridin-2-yl]methanol |
|---|---|
| PubChem CID | 11334708 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | [(2S,3S)-1-(4-methylphenyl)sulfonyl-3-propylaziridin-2-yl]methanol |
| SMILES | CCC[C@H]1[C@@H](CO)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H19NO3S/c1-3-4-12-13(9-15)14(12)18(16,17)11-7-5-10(2)6-8-11/h5-8,12-13,15H,3-4,9H2,1-2H3/t12-,13+,14?/m0/s1 |
| InChIKey | JNJMLZMGCCYXMG-WLDKUNSKSA-N |
| XLogP | 1.53 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|