C19H33NO3SSi — CID 11269094
tert-butyl-dimethyl-[[1-(4-methylphenyl)sulfonyl-3-propylaziridin-2-yl]methoxy]silane (PubChem CID 11269094) has the molecular formula C19H33NO3SSi and a molecular weight of 383.63 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[1-(4-methylphenyl)sulfonyl-3-propylaziridin-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[1-(4-methylphenyl)sulfonyl-3-propylaziridin-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 11269094 |
| Molecular Formula | C19H33NO3SSi |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | tert-butyl-dimethyl-[[1-(4-methylphenyl)sulfonyl-3-propylaziridin-2-yl]methoxy]silane |
| SMILES | CCCC1C(CO[Si](C)(C)C(C)(C)C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H33NO3SSi/c1-8-9-17-18(14-23-25(6,7)19(3,4)5)20(17)24(21,22)16-12-10-15(2)11-13-16/h10-13,17-18H,8-9,14H2,1-7H3 |
| InChIKey | FJCMEJGTDPQQAN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|