C25H37NO4SSi — CID 102079275
tert-butyl-[2-[(2S,4R)-4-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylazetidin-2-yl]ethoxy]-dimethylsilane (PubChem CID 102079275) has the molecular formula C25H37NO4SSi and a molecular weight of 475.73 g/mol. Its IUPAC name is tert-butyl-[2-[(2S,4R)-4-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylazetidin-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(2S,4R)-4-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylazetidin-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102079275 |
| Molecular Formula | C25H37NO4SSi |
| Molecular Weight | 475.73 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | tert-butyl-[2-[(2S,4R)-4-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylazetidin-2-yl]ethoxy]-dimethylsilane |
| SMILES | COc1ccc([C@H]2C[C@@H](CCO[Si](C)(C)C(C)(C)C)N2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H37NO4SSi/c1-19-8-14-23(15-9-19)31(27,28)26-21(16-17-30-32(6,7)25(2,3)4)18-24(26)20-10-12-22(29-5)13-11-20/h8-15,21,24H,16-18H2,1-7H3/t21-,24-/m1/s1 |
| InChIKey | JQVYRDVEMIUAMM-ZJSXRUAMSA-N |
| XLogP | 5.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.73 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|