C17H29NO2Si — CID 10494970
tert-butyl-[2-[1-(4-methoxyphenyl)aziridin-2-yl]ethoxy]-dimethylsilane (PubChem CID 10494970) has the molecular formula C17H29NO2Si and a molecular weight of 307.51 g/mol. Its IUPAC name is tert-butyl-[2-[1-(4-methoxyphenyl)aziridin-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[1-(4-methoxyphenyl)aziridin-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10494970 |
| Molecular Formula | C17H29NO2Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | tert-butyl-[2-[1-(4-methoxyphenyl)aziridin-2-yl]ethoxy]-dimethylsilane |
| SMILES | COc1ccc(N2CC2CCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H29NO2Si/c1-17(2,3)21(5,6)20-12-11-15-13-18(15)14-7-9-16(19-4)10-8-14/h7-10,15H,11-13H2,1-6H3 |
| InChIKey | ZPAMVMITKWVQRO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|