C31H42N2O2Si — CID 11432068
(1R)-N,N-dibenzyl-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-1-(4-methoxyphenyl)aziridin-2-yl]ethanamine (PubChem CID 11432068) has the molecular formula C31H42N2O2Si and a molecular weight of 502.78 g/mol. Its IUPAC name is (1R)-N,N-dibenzyl-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-1-(4-methoxyphenyl)aziridin-2-yl]ethanamine.
| Compound Name | (1R)-N,N-dibenzyl-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-1-(4-methoxyphenyl)aziridin-2-yl]ethanamine |
|---|---|
| PubChem CID | 11432068 |
| Molecular Formula | C31H42N2O2Si |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | (1R)-N,N-dibenzyl-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2S)-1-(4-methoxyphenyl)aziridin-2-yl]ethanamine |
| SMILES | COc1ccc(N2C[C@H]2[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H42N2O2Si/c1-31(2,3)36(5,6)35-24-30(29-23-33(29)27-17-19-28(34-4)20-18-27)32(21-25-13-9-7-10-14-25)22-26-15-11-8-12-16-26/h7-20,29-30H,21-24H2,1-6H3/t29-,30-,33?/m0/s1 |
| InChIKey | WLSKMWONHBONFK-BVKSZRQYSA-N |
| XLogP | 6.98 |
| TPSA | 24.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|