C27H32N2O — CID 11361595
(1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine (PubChem CID 11361595) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine.
| Compound Name | (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 11361595 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine |
| SMILES | COc1ccc(N2C[C@@H]2[C@H](C(C)C)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N2O/c1-21(2)27(26-20-29(26)24-14-16-25(30-3)17-15-24)28(18-22-10-6-4-7-11-22)19-23-12-8-5-9-13-23/h4-17,21,26-27H,18-20H2,1-3H3/t26-,27+,29?/m1/s1 |
| InChIKey | HFMJLOYOKFLZGV-QZIBZCQVSA-N |
| XLogP | 5.61 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|