About (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine
(1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine (PubChem CID 11361595) has the molecular formula C27H32N2O
and a molecular weight of 400.57 g/mol. Its IUPAC name is (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine |
| PubChem CID | 11361595 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine |
| SMILES | COc1ccc(N2C[C@@H]2[C@H](C(C)C)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N2O/c1-21(2)27(26-20-29(26)24-14-16-25(30-3)17-15-24)28(18-22-10-6-4-7-11-22)19-23-12-8-5-9-13-23/h4-17,21,26-27H,18-20H2,1-3H3/t26-,27+,29?/m1/s1 |
| InChIKey | HFMJLOYOKFLZGV-QZIBZCQVSA-N |
| XLogP | 5.61 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine?
The IUPAC name of (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine (CID 11361595) is (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine.
What is the SMILES notation for (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine?
The canonical SMILES for (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine is COc1ccc(N2C[C@@H]2[C@H](C(C)C)N(Cc2ccccc2)Cc2ccccc2)cc1.
What is the InChIKey of (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine?
The InChIKey is HFMJLOYOKFLZGV-QZIBZCQVSA-N. The full InChI is InChI=1S/C27H32N2O/c1-21(2)27(26-20-29(26)24-14-16-25(30-3)17-15-24)28(18-22-10-6-4-7-11-22)19-23-12-8-5-9-13-23/h4-17,21,26-27H,18-20H2,1-3H3/t26-,27+,29?/m1/s1.
What are the key properties of (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine?
(1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine has a molecular weight of 400.57 g/mol, XLogP of 5.61, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N,N-dibenzyl-1-[(2R)-1-(4-methoxyphenyl)aziridin-2-yl]-2-methylpropan-1-amine is sourced from PubChem (CID 11361595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).