C14H21NO3 — CID 101012391
(2R,3S)-2-(dimethoxymethyl)-1-(4-methoxyphenyl)-3-methylazetidine (PubChem CID 101012391) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (2R,3S)-2-(dimethoxymethyl)-1-(4-methoxyphenyl)-3-methylazetidine.
| Compound Name | (2R,3S)-2-(dimethoxymethyl)-1-(4-methoxyphenyl)-3-methylazetidine |
|---|---|
| PubChem CID | 101012391 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (2R,3S)-2-(dimethoxymethyl)-1-(4-methoxyphenyl)-3-methylazetidine |
| SMILES | COc1ccc(N2C[C@H](C)[C@@H]2C(OC)OC)cc1 |
| InChI | InChI=1S/C14H21NO3/c1-10-9-15(13(10)14(17-3)18-4)11-5-7-12(16-2)8-6-11/h5-8,10,13-14H,9H2,1-4H3/t10-,13+/m0/s1 |
| InChIKey | RUHUYUYEGPIRCM-GXFFZTMASA-N |
| XLogP | 2.14 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|