C13H20N2O — CID 95443898
(2S,5R)-1-(4-methoxyphenyl)-2,5-dimethylpiperazine (PubChem CID 95443898) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is (2S,5R)-1-(4-methoxyphenyl)-2,5-dimethylpiperazine.
| Compound Name | (2S,5R)-1-(4-methoxyphenyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 95443898 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (2S,5R)-1-(4-methoxyphenyl)-2,5-dimethylpiperazine |
| SMILES | COc1ccc(N2C[C@@H](C)NC[C@@H]2C)cc1 |
| InChI | InChI=1S/C13H20N2O/c1-10-9-15(11(2)8-14-10)12-4-6-13(16-3)7-5-12/h4-7,10-11,14H,8-9H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | LWSNTKGYLRKNRD-MNOVXSKESA-N |
| XLogP | 1.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|