C12H17BrN2 — CID 95472777
(2S,5R)-1-(4-bromophenyl)-2,5-dimethylpiperazine (PubChem CID 95472777) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is (2S,5R)-1-(4-bromophenyl)-2,5-dimethylpiperazine.
| Compound Name | (2S,5R)-1-(4-bromophenyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 95472777 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (2S,5R)-1-(4-bromophenyl)-2,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN(c2ccc(Br)cc2)[C@@H](C)CN1 |
| InChI | InChI=1S/C12H17BrN2/c1-9-8-15(10(2)7-14-9)12-5-3-11(13)4-6-12/h3-6,9-10,14H,7-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | FIOHEHQMLAPMRP-ZJUUUORDSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |