C11H17N3 — CID 64983891
2,5-dimethyl-1-pyridin-4-ylpiperazine (PubChem CID 64983891) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 2,5-dimethyl-1-pyridin-4-ylpiperazine.
| Compound Name | 2,5-dimethyl-1-pyridin-4-ylpiperazine |
|---|---|
| PubChem CID | 64983891 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2,5-dimethyl-1-pyridin-4-ylpiperazine |
| SMILES | CC1CN(c2ccncc2)C(C)CN1 |
| InChI | InChI=1S/C11H17N3/c1-9-8-14(10(2)7-13-9)11-3-5-12-6-4-11/h3-6,9-10,13H,7-8H2,1-2H3 |
| InChIKey | VRWSQHAAKQKDAD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |