C12H19N3 — CID 64936270
2,5-dimethyl-1-(4-methyl-3-pyridinyl)piperazine (PubChem CID 64936270) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 2,5-dimethyl-1-(4-methyl-3-pyridinyl)piperazine.
| Compound Name | 2,5-dimethyl-1-(4-methyl-3-pyridinyl)piperazine |
|---|---|
| PubChem CID | 64936270 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 2,5-dimethyl-1-(4-methyl-3-pyridinyl)piperazine |
| SMILES | Cc1ccncc1N1CC(C)NCC1C |
| InChI | InChI=1S/C12H19N3/c1-9-4-5-13-7-12(9)15-8-10(2)14-6-11(15)3/h4-5,7,10-11,14H,6,8H2,1-3H3 |
| InChIKey | GVKTVWGBFOHVCH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |