C13H19FN2 — CID 64937185
1-(3-fluoro-2-methylphenyl)-2,5-dimethylpiperazine (PubChem CID 64937185) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-(3-fluoro-2-methylphenyl)-2,5-dimethylpiperazine.
| Compound Name | 1-(3-fluoro-2-methylphenyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 64937185 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-(3-fluoro-2-methylphenyl)-2,5-dimethylpiperazine |
| SMILES | Cc1c(F)cccc1N1CC(C)NCC1C |
| InChI | InChI=1S/C13H19FN2/c1-9-8-16(10(2)7-15-9)13-6-4-5-12(14)11(13)3/h4-6,9-10,15H,7-8H2,1-3H3 |
| InChIKey | MTAIQYBGMIFJTF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |