C12H16BrClN2 — CID 107617341
1-(4-bromo-3-chlorophenyl)-2,5-dimethylpiperazine (PubChem CID 107617341) has the molecular formula C12H16BrClN2 and a molecular weight of 303.63 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-2,5-dimethylpiperazine.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 107617341 |
| Molecular Formula | C12H16BrClN2 |
| Molecular Weight | 303.63 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-2,5-dimethylpiperazine |
| SMILES | CC1CN(c2ccc(Br)c(Cl)c2)C(C)CN1 |
| InChI | InChI=1S/C12H16BrClN2/c1-8-7-16(9(2)6-15-8)10-3-4-11(13)12(14)5-10/h3-5,8-9,15H,6-7H2,1-2H3 |
| InChIKey | QUTQXQYBBABKBU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.63 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |