C16H22N4O2 — CID 171406974
1-[4-[(2R,5S)-2,5-dimethylpiperazin-1-yl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 171406974) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-[4-[(2R,5S)-2,5-dimethylpiperazin-1-yl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-[(2R,5S)-2,5-dimethylpiperazin-1-yl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 171406974 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-[4-[(2R,5S)-2,5-dimethylpiperazin-1-yl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | C[C@@H]1CN[C@@H](C)CN1c1ccc(N2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C16H22N4O2/c1-11-10-20(12(2)9-17-11)14-5-3-13(4-6-14)19-8-7-15(21)18-16(19)22/h3-6,11-12,17H,7-10H2,1-2H3,(H,18,21,22)/t11-,12+/m0/s1 |
| InChIKey | UMSYHUFJHDYKAP-NWDGAFQWSA-N |
| XLogP | 1.32 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |