C11H12N2O4S — CID 177010511
1-(4-methylsulfonylphenyl)-1,3-diazinane-2,4-dione (PubChem CID 177010511) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(4-methylsulfonylphenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177010511 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)-1,3-diazinane-2,4-dione |
| SMILES | CS(=O)(=O)c1ccc(N2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C11H12N2O4S/c1-18(16,17)9-4-2-8(3-5-9)13-7-6-10(14)12-11(13)15/h2-5H,6-7H2,1H3,(H,12,14,15) |
| InChIKey | DKWPBSXXQRDIKA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |