About 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione
1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione (PubChem CID 176705840) has the molecular formula C18H21N3O3
and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione |
| PubChem CID | 176705840 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCC2(CC1)CN(c1ccc(N3CCC(=O)NC3=O)cc1)C2 |
| InChI | InChI=1S/C18H21N3O3/c22-15-5-8-18(9-6-15)11-20(12-18)13-1-3-14(4-2-13)21-10-7-16(23)19-17(21)24/h1-4H,5-12H2,(H,19,23,24) |
| InChIKey | CQLLXMUMEFEDMN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione?
The IUPAC name of 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione (CID 176705840) is 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione.
What is the SMILES notation for 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione?
The canonical SMILES for 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione is O=C1CCC2(CC1)CN(c1ccc(N3CCC(=O)NC3=O)cc1)C2.
What is the InChIKey of 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione?
The InChIKey is CQLLXMUMEFEDMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O3/c22-15-5-8-18(9-6-15)11-20(12-18)13-1-3-14(4-2-13)21-10-7-16(23)19-17(21)24/h1-4H,5-12H2,(H,19,23,24).
What are the key properties of 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione?
1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione has a molecular weight of 327.38 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(7-oxo-2-azaspiro[3.5]nonan-2-yl)phenyl]-1,3-diazinane-2,4-dione is sourced from PubChem (CID 176705840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).