C11H11N3O3 — CID 23023749
4-(2,4-dioxo-1,3-diazinan-1-yl)benzamide (PubChem CID 23023749) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-(2,4-dioxo-1,3-diazinan-1-yl)benzamide.
| Compound Name | 4-(2,4-dioxo-1,3-diazinan-1-yl)benzamide |
|---|---|
| PubChem CID | 23023749 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-(2,4-dioxo-1,3-diazinan-1-yl)benzamide |
| SMILES | NC(=O)c1ccc(N2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C11H11N3O3/c12-10(16)7-1-3-8(4-2-7)14-6-5-9(15)13-11(14)17/h1-4H,5-6H2,(H2,12,16)(H,13,15,17) |
| InChIKey | CTMIFROIMKRTGI-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |