C18H25N5O4 — CID 174225423
3-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]propylcarbamic acid (PubChem CID 174225423) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]propylcarbamic acid.
| Compound Name | 3-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]propylcarbamic acid |
|---|---|
| PubChem CID | 174225423 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 3-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]propylcarbamic acid |
| SMILES | O=C(O)NCCCN1CCN(c2ccc(N3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C18H25N5O4/c24-16-6-9-23(17(25)20-16)15-4-2-14(3-5-15)22-12-10-21(11-13-22)8-1-7-19-18(26)27/h2-5,19H,1,6-13H2,(H,26,27)(H,20,24,25) |
| InChIKey | DICBEEUSKSGVNC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|