C22H33N5O4 — CID 164540928
tert-butyl N-[3-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]propyl]carbamate (PubChem CID 164540928) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 164540928 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | tert-butyl N-[3-[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)phenyl]piperazin-1-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN1CCN(c2ccc(N3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C22H33N5O4/c1-22(2,3)31-21(30)23-10-4-11-25-13-15-26(16-14-25)17-5-7-18(8-6-17)27-12-9-19(28)24-20(27)29/h5-8H,4,9-16H2,1-3H3,(H,23,30)(H,24,28,29) |
| InChIKey | UJIQBFZVIXZFEP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|