C24H32N6O5 — CID 166142061
tert-butyl N-[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]piperazin-1-yl]ethyl]carbamate (PubChem CID 166142061) has the molecular formula C24H32N6O5 and a molecular weight of 484.56 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]piperazin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]piperazin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 166142061 |
| Molecular Formula | C24H32N6O5 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | tert-butyl N-[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]piperazin-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN1CCN(c2ccc3c(=O)n(C4CCC(=O)NC4=O)ncc3c2)CC1 |
| InChI | InChI=1S/C24H32N6O5/c1-24(2,3)35-23(34)25-8-9-28-10-12-29(13-11-28)17-4-5-18-16(14-17)15-26-30(22(18)33)19-6-7-20(31)27-21(19)32/h4-5,14-15,19H,6-13H2,1-3H3,(H,25,34)(H,27,31,32) |
| InChIKey | JFSINLAEYRLAIS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|