C30H35N7O4 — CID 171724562
2-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]piperazin-1-yl]methyl]piperidin-1-yl]benzamide (PubChem CID 171724562) has the molecular formula C30H35N7O4 and a molecular weight of 557.66 g/mol. Its IUPAC name is 2-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]piperazin-1-yl]methyl]piperidin-1-yl]benzamide.
| Compound Name | 2-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]piperazin-1-yl]methyl]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 171724562 |
| Molecular Formula | C30H35N7O4 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 2-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxophthalazin-6-yl]piperazin-1-yl]methyl]piperidin-1-yl]benzamide |
| SMILES | NC(=O)c1ccccc1N1CCC(CN2CCN(c3ccc4c(=O)n(C5CCC(=O)NC5=O)ncc4c3)CC2)CC1 |
| InChI | InChI=1S/C30H35N7O4/c31-28(39)24-3-1-2-4-25(24)36-11-9-20(10-12-36)19-34-13-15-35(16-14-34)22-5-6-23-21(17-22)18-32-37(30(23)41)26-7-8-27(38)33-29(26)40/h1-6,17-18,20,26H,7-16,19H2,(H2,31,39)(H,33,38,40) |
| InChIKey | HPJDOSYHOAJAJF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|