C43H46N6O4 — CID 170706297
3-[5-[4-[[1-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]indazol-1-yl]piperidine-2,6-dione (PubChem CID 170706297) has the molecular formula C43H46N6O4 and a molecular weight of 710.88 g/mol. Its IUPAC name is 3-[5-[4-[[1-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]indazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-[[1-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]indazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170706297 |
| Molecular Formula | C43H46N6O4 |
| Molecular Weight | 710.88 g/mol |
| Exact Mass | 710.36 |
| IUPAC Name | 3-[5-[4-[[1-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-1H-isochromen-4-yl]phenyl]piperidin-4-yl]methyl]piperazin-1-yl]indazol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2ncc3cc(N4CCN(CC5CCN(c6ccc([C@@H]7c8ccc(O)cc8CO[C@@H]7c7ccccc7)cc6)CC5)CC4)ccc32)C(=O)N1 |
| InChI | InChI=1S/C43H46N6O4/c50-36-11-12-37-33(25-36)28-53-42(31-4-2-1-3-5-31)41(37)30-6-8-34(9-7-30)47-18-16-29(17-19-47)27-46-20-22-48(23-21-46)35-10-13-38-32(24-35)26-44-49(38)39-14-15-40(51)45-43(39)52/h1-13,24-26,29,39,41-42,50H,14-23,27-28H2,(H,45,51,52)/t39?,41-,42-/m1/s1 |
| InChIKey | JIHTVLQFROCEKO-FPRBQUIYSA-N |
| XLogP | 6.16 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.88 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|