C31H46N6O6 — CID 166118284
tert-butyl N-[2-[4-[[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperazin-1-yl]methyl]cyclohexyl]oxyethyl]carbamate (PubChem CID 166118284) has the molecular formula C31H46N6O6 and a molecular weight of 598.75 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperazin-1-yl]methyl]cyclohexyl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperazin-1-yl]methyl]cyclohexyl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 166118284 |
| Molecular Formula | C31H46N6O6 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | tert-butyl N-[2-[4-[[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperazin-1-yl]methyl]cyclohexyl]oxyethyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(N3CCN(CC4CCC(OCCNC(=O)OC(C)(C)C)CC4)CC3)cc21 |
| InChI | InChI=1S/C31H46N6O6/c1-31(2,3)43-29(40)32-13-18-42-23-8-5-21(6-9-23)20-35-14-16-36(17-15-35)22-7-10-24-26(19-22)34(4)30(41)37(24)25-11-12-27(38)33-28(25)39/h7,10,19,21,23,25H,5-6,8-9,11-18,20H2,1-4H3,(H,32,40)(H,33,38,39) |
| InChIKey | VBALRKOBLZWXOU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|