C26H38N6O4 — CID 166118191
3-[5-[4-[[4-(2-aminoethoxy)cyclohexyl]methyl]piperazin-1-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 166118191) has the molecular formula C26H38N6O4 and a molecular weight of 498.63 g/mol. Its IUPAC name is 3-[5-[4-[[4-(2-aminoethoxy)cyclohexyl]methyl]piperazin-1-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[4-[[4-(2-aminoethoxy)cyclohexyl]methyl]piperazin-1-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166118191 |
| Molecular Formula | C26H38N6O4 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 3-[5-[4-[[4-(2-aminoethoxy)cyclohexyl]methyl]piperazin-1-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(N3CCN(CC4CCC(OCCN)CC4)CC3)cc21 |
| InChI | InChI=1S/C26H38N6O4/c1-29-23-16-19(4-7-21(23)32(26(29)35)22-8-9-24(33)28-25(22)34)31-13-11-30(12-14-31)17-18-2-5-20(6-3-18)36-15-10-27/h4,7,16,18,20,22H,2-3,5-6,8-15,17,27H2,1H3,(H,28,33,34) |
| InChIKey | XOSOVPCGHBTRHU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|