C28H41N5O4 — CID 166118276
3-[3-methyl-5-[1-[[4-[2-(methylamino)ethoxy]cyclohexyl]methyl]piperidin-4-yl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 166118276) has the molecular formula C28H41N5O4 and a molecular weight of 511.67 g/mol. Its IUPAC name is 3-[3-methyl-5-[1-[[4-[2-(methylamino)ethoxy]cyclohexyl]methyl]piperidin-4-yl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-methyl-5-[1-[[4-[2-(methylamino)ethoxy]cyclohexyl]methyl]piperidin-4-yl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166118276 |
| Molecular Formula | C28H41N5O4 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | 3-[3-methyl-5-[1-[[4-[2-(methylamino)ethoxy]cyclohexyl]methyl]piperidin-4-yl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | CNCCOC1CCC(CN2CCC(c3ccc4c(c3)n(C)c(=O)n4C3CCC(=O)NC3=O)CC2)CC1 |
| InChI | InChI=1S/C28H41N5O4/c1-29-13-16-37-22-6-3-19(4-7-22)18-32-14-11-20(12-15-32)21-5-8-23-25(17-21)31(2)28(36)33(23)24-9-10-26(34)30-27(24)35/h5,8,17,19-20,22,24,29H,3-4,6-7,9-16,18H2,1-2H3,(H,30,34,35) |
| InChIKey | CPRKIKCPTKITFE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|