C19H22N4O4 — CID 156798922
4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperidine-1-carbaldehyde (PubChem CID 156798922) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperidine-1-carbaldehyde.
| Compound Name | 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 156798922 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]piperidine-1-carbaldehyde |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C3CCN(C=O)CC3)cc21 |
| InChI | InChI=1S/C19H22N4O4/c1-21-16-10-13(12-6-8-22(11-24)9-7-12)2-3-14(16)23(19(21)27)15-4-5-17(25)20-18(15)26/h2-3,10-12,15H,4-9H2,1H3,(H,20,25,26) |
| InChIKey | SVJLZDDHWPTYOB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|