C24H33N5O5 — CID 166549579
tert-butyl 2-[(3S)-4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]-3-methylpiperazin-1-yl]acetate (PubChem CID 166549579) has the molecular formula C24H33N5O5 and a molecular weight of 471.56 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]-3-methylpiperazin-1-yl]acetate.
| Compound Name | tert-butyl 2-[(3S)-4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]-3-methylpiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 166549579 |
| Molecular Formula | C24H33N5O5 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | tert-butyl 2-[(3S)-4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]-3-methylpiperazin-1-yl]acetate |
| SMILES | C[C@H]1CN(CC(=O)OC(C)(C)C)CCN1c1ccc2c(c1)n(C)c(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H33N5O5/c1-15-13-27(14-21(31)34-24(2,3)4)10-11-28(15)16-6-7-17-19(12-16)26(5)23(33)29(17)18-8-9-20(30)25-22(18)32/h6-7,12,15,18H,8-11,13-14H2,1-5H3,(H,25,30,32)/t15-,18?/m0/s1 |
| InChIKey | PWMYJHRBJLTVFF-BUSXIPJBSA-N |
| XLogP | 1.17 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|