C26H35N3O5 — CID 155170182
tert-butyl 2-[4-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]cyclohexyl]acetate (PubChem CID 155170182) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is tert-butyl 2-[4-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]cyclohexyl]acetate.
| Compound Name | tert-butyl 2-[4-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 155170182 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | tert-butyl 2-[4-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]methyl]cyclohexyl]acetate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(CC3CCC(CC(=O)OC(C)(C)C)CC3)cc21 |
| InChI | InChI=1S/C26H35N3O5/c1-26(2,3)34-23(31)15-17-7-5-16(6-8-17)13-18-9-10-19-21(14-18)28(4)25(33)29(19)20-11-12-22(30)27-24(20)32/h9-10,14,16-17,20H,5-8,11-13,15H2,1-4H3,(H,27,30,32) |
| InChIKey | XRZCPMJNWLZNJI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|