C24H37ClN4O5 — CID 138695722
3-[5-[3-[3-(3-aminopropoxy)-2,2-dimethylpropoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 138695722) has the molecular formula C24H37ClN4O5 and a molecular weight of 497.04 g/mol. Its IUPAC name is 3-[5-[3-[3-(3-aminopropoxy)-2,2-dimethylpropoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[5-[3-[3-(3-aminopropoxy)-2,2-dimethylpropoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 138695722 |
| Molecular Formula | C24H37ClN4O5 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 3-[5-[3-[3-(3-aminopropoxy)-2,2-dimethylpropoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(CCCOCC(C)(C)COCCCN)cc21 |
| InChI | InChI=1S/C24H36N4O5.ClH/c1-24(2,16-33-13-5-11-25)15-32-12-4-6-17-7-8-18-20(14-17)27(3)23(31)28(18)19-9-10-21(29)26-22(19)30;/h7-8,14,19H,4-6,9-13,15-16,25H2,1-3H3,(H,26,29,30);1H |
| InChIKey | CFKMWACPARIQTN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|