C20H29ClN4O5 — CID 167712757
3-[5-[3-[2-(2-aminoethoxy)ethoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 167712757) has the molecular formula C20H29ClN4O5 and a molecular weight of 440.93 g/mol. Its IUPAC name is 3-[5-[3-[2-(2-aminoethoxy)ethoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[5-[3-[2-(2-aminoethoxy)ethoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 167712757 |
| Molecular Formula | C20H29ClN4O5 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 3-[5-[3-[2-(2-aminoethoxy)ethoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(CCCOCCOCCN)cc21 |
| InChI | InChI=1S/C20H28N4O5.ClH/c1-23-17-13-14(3-2-9-28-11-12-29-10-8-21)4-5-15(17)24(20(23)27)16-6-7-18(25)22-19(16)26;/h4-5,13,16H,2-3,6-12,21H2,1H3,(H,22,25,26);1H |
| InChIKey | GLADHPJESZWPAW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|