C25H36N4O5 — CID 174216125
butyl N-[7-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]heptyl]carbamate (PubChem CID 174216125) has the molecular formula C25H36N4O5 and a molecular weight of 472.59 g/mol. Its IUPAC name is butyl N-[7-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]heptyl]carbamate.
| Compound Name | butyl N-[7-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]heptyl]carbamate |
|---|---|
| PubChem CID | 174216125 |
| Molecular Formula | C25H36N4O5 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | butyl N-[7-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]heptyl]carbamate |
| SMILES | CCCCOC(=O)NCCCCCCCc1ccc2c(c1)n(C)c(=O)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C25H36N4O5/c1-3-4-16-34-24(32)26-15-9-7-5-6-8-10-18-11-12-19-21(17-18)28(2)25(33)29(19)20-13-14-22(30)27-23(20)31/h11-12,17,20H,3-10,13-16H2,1-2H3,(H,26,32)(H,27,30,31) |
| InChIKey | BWFOHXJPJAFPAE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|