C20H25N3O4 — CID 167663755
3-[3-methyl-5-[2-(3-methylcyclobutyl)oxyethyl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 167663755) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[3-methyl-5-[2-(3-methylcyclobutyl)oxyethyl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-methyl-5-[2-(3-methylcyclobutyl)oxyethyl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167663755 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-[3-methyl-5-[2-(3-methylcyclobutyl)oxyethyl]-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | CC1CC(OCCc2ccc3c(c2)n(C)c(=O)n3C2CCC(=O)NC2=O)C1 |
| InChI | InChI=1S/C20H25N3O4/c1-12-9-14(10-12)27-8-7-13-3-4-15-17(11-13)22(2)20(26)23(15)16-5-6-18(24)21-19(16)25/h3-4,11-12,14,16H,5-10H2,1-2H3,(H,21,24,25) |
| InChIKey | RPQFHZDWKUOFDJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|