C28H42N6O4 — CID 167243097
3-[5-[[4-[3-(4-ethylpiperazin-1-yl)propoxy]piperidin-1-yl]methyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 167243097) has the molecular formula C28H42N6O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is 3-[5-[[4-[3-(4-ethylpiperazin-1-yl)propoxy]piperidin-1-yl]methyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[4-[3-(4-ethylpiperazin-1-yl)propoxy]piperidin-1-yl]methyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167243097 |
| Molecular Formula | C28H42N6O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | 3-[5-[[4-[3-(4-ethylpiperazin-1-yl)propoxy]piperidin-1-yl]methyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | CCN1CCN(CCCOC2CCN(Cc3ccc4c(c3)n(C)c(=O)n4C3CCC(=O)NC3=O)CC2)CC1 |
| InChI | InChI=1S/C28H42N6O4/c1-3-31-14-16-32(17-15-31)11-4-18-38-22-9-12-33(13-10-22)20-21-5-6-23-25(19-21)30(2)28(37)34(23)24-7-8-26(35)29-27(24)36/h5-6,19,22,24H,3-4,7-18,20H2,1-2H3,(H,29,35,36) |
| InChIKey | ATHKICSDBPLIGZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|