C27H38N4O4 — CID 156860636
3-[5-[2-(1-cyclohexylpiperidin-4-yl)ethyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;formaldehyde (PubChem CID 156860636) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 3-[5-[2-(1-cyclohexylpiperidin-4-yl)ethyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;formaldehyde.
| Compound Name | 3-[5-[2-(1-cyclohexylpiperidin-4-yl)ethyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;formaldehyde |
|---|---|
| PubChem CID | 156860636 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 3-[5-[2-(1-cyclohexylpiperidin-4-yl)ethyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione;formaldehyde |
| SMILES | C=O.Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(CCC3CCN(C4CCCCC4)CC3)cc21 |
| InChI | InChI=1S/C26H36N4O3.CH2O/c1-28-23-17-19(8-7-18-13-15-29(16-14-18)20-5-3-2-4-6-20)9-10-21(23)30(26(28)33)22-11-12-24(31)27-25(22)32;1-2/h9-10,17-18,20,22H,2-8,11-16H2,1H3,(H,27,31,32);1H2 |
| InChIKey | XSVAQHRCEWYVNL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|