C22H27N3O5 — CID 155189625
2-[4-[[1-[(3S)-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]methyl]cyclohexyl]acetic acid (PubChem CID 155189625) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-[4-[[1-[(3S)-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[[1-[(3S)-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 155189625 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[4-[[1-[(3S)-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-5-yl]methyl]cyclohexyl]acetic acid |
| SMILES | Cn1c(=O)n([C@H]2CCC(=O)NC2=O)c2ccc(CC3CCC(CC(=O)O)CC3)cc21 |
| InChI | InChI=1S/C22H27N3O5/c1-24-18-11-15(10-13-2-4-14(5-3-13)12-20(27)28)6-7-16(18)25(22(24)30)17-8-9-19(26)23-21(17)29/h6-7,11,13-14,17H,2-5,8-10,12H2,1H3,(H,27,28)(H,23,26,29)/t13?,14?,17-/m0/s1 |
| InChIKey | WTNLGPQWICQJBV-KVULBXGLSA-N |
| XLogP | 2.14 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|