C20H26N4O5 — CID 155177682
7-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]amino]heptanoic acid (PubChem CID 155177682) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is 7-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]amino]heptanoic acid.
| Compound Name | 7-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]amino]heptanoic acid |
|---|---|
| PubChem CID | 155177682 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 7-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]amino]heptanoic acid |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(NCCCCCCC(=O)O)cc21 |
| InChI | InChI=1S/C20H26N4O5/c1-23-16-12-13(21-11-5-3-2-4-6-18(26)27)7-8-14(16)24(20(23)29)15-9-10-17(25)22-19(15)28/h7-8,12,15,21H,2-6,9-11H2,1H3,(H,26,27)(H,22,25,28) |
| InChIKey | GZVOJMSMHJRPDN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|